C22H19FN8O — CID 134535758
5-(4-amino-3-methoxyphenyl)-7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 134535758) has the molecular formula C22H19FN8O and a molecular weight of 430.45 g/mol. Its IUPAC name is 5-(4-amino-3-methoxyphenyl)-7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-amino-3-methoxyphenyl)-7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134535758 |
| Molecular Formula | C22H19FN8O |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-(4-amino-3-methoxyphenyl)-7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cc(-c2cn(Cc3cn(-c4ccccc4F)nn3)c3ncnc(N)c23)ccc1N |
| InChI | InChI=1S/C22H19FN8O/c1-32-19-8-13(6-7-17(19)24)15-11-30(22-20(15)21(25)26-12-27-22)9-14-10-31(29-28-14)18-5-3-2-4-16(18)23/h2-8,10-12H,9,24H2,1H3,(H2,25,26,27) |
| InChIKey | AJQNTGVBPJGJDB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|