C21H25N5O3 — CID 22736421
5-(4-amino-3-methoxyphenyl)-7-(1,4-dioxaspiro[4.5]decan-8-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 22736421) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-(4-amino-3-methoxyphenyl)-7-(1,4-dioxaspiro[4.5]decan-8-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-amino-3-methoxyphenyl)-7-(1,4-dioxaspiro[4.5]decan-8-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22736421 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-(4-amino-3-methoxyphenyl)-7-(1,4-dioxaspiro[4.5]decan-8-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cc(-c2cn(C3CCC4(CC3)OCCO4)c3ncnc(N)c23)ccc1N |
| InChI | InChI=1S/C21H25N5O3/c1-27-17-10-13(2-3-16(17)22)15-11-26(20-18(15)19(23)24-12-25-20)14-4-6-21(7-5-14)28-8-9-29-21/h2-3,10-12,14H,4-9,22H2,1H3,(H2,23,24,25) |
| InChIKey | SXMBLIAVBGVJIF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|