C24H33FN6 — CID 143087740
5-(4-amino-3-fluorophenyl)-7-[4-(dipropylamino)cyclohexyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 143087740) has the molecular formula C24H33FN6 and a molecular weight of 424.57 g/mol. Its IUPAC name is 5-(4-amino-3-fluorophenyl)-7-[4-(dipropylamino)cyclohexyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-(4-amino-3-fluorophenyl)-7-[4-(dipropylamino)cyclohexyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143087740 |
| Molecular Formula | C24H33FN6 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 5-(4-amino-3-fluorophenyl)-7-[4-(dipropylamino)cyclohexyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCN(CCC)C1CCC(n2cc(-c3ccc(N)c(F)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C24H33FN6/c1-3-11-30(12-4-2)17-6-8-18(9-7-17)31-14-19(16-5-10-21(26)20(25)13-16)22-23(27)28-15-29-24(22)31/h5,10,13-15,17-18H,3-4,6-9,11-12,26H2,1-2H3,(H2,27,28,29) |
| InChIKey | GWCBQKSYPMFQNB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|