C17H14FIN8 — CID 134536184
N-[7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N'-methylmethanimidamide (PubChem CID 134536184) has the molecular formula C17H14FIN8 and a molecular weight of 476.26 g/mol. Its IUPAC name is N-[7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N'-methylmethanimidamide.
| Compound Name | N-[7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 134536184 |
| Molecular Formula | C17H14FIN8 |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-[7-[[1-(2-fluorophenyl)triazol-4-yl]methyl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/Nc1ncnc2c1c(I)cn2Cc1cn(-c2ccccc2F)nn1 |
| InChI | InChI=1S/C17H14FIN8/c1-20-9-21-16-15-13(19)8-26(17(15)23-10-22-16)6-11-7-27(25-24-11)14-5-3-2-4-12(14)18/h2-5,7-10H,6H2,1H3,(H,20,21,22,23) |
| InChIKey | SFALVHAWPYUPEH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|