C12H14F2N4 — CID 66207319
N-[[1-(2,3-difluorophenyl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 66207319) has the molecular formula C12H14F2N4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[[1-(2,3-difluorophenyl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2,3-difluorophenyl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66207319 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-[[1-(2,3-difluorophenyl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2cccc(F)c2F)nn1 |
| InChI | InChI=1S/C12H14F2N4/c1-2-6-15-7-9-8-18(17-16-9)11-5-3-4-10(13)12(11)14/h3-5,8,15H,2,6-7H2,1H3 |
| InChIKey | IXXUMJOEWILJBP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|