C12H14Br2N4 — CID 66205081
N-[[1-(2,5-dibromophenyl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 66205081) has the molecular formula C12H14Br2N4 and a molecular weight of 374.08 g/mol. Its IUPAC name is N-[[1-(2,5-dibromophenyl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2,5-dibromophenyl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66205081 |
| Molecular Formula | C12H14Br2N4 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | N-[[1-(2,5-dibromophenyl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2cc(Br)ccc2Br)nn1 |
| InChI | InChI=1S/C12H14Br2N4/c1-2-5-15-7-10-8-18(17-16-10)12-6-9(13)3-4-11(12)14/h3-4,6,8,15H,2,5,7H2,1H3 |
| InChIKey | WQVXHPOXFNSXPN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|