C13H14BrF3N4 — CID 66204894
N-[[1-[3-bromo-5-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 66204894) has the molecular formula C13H14BrF3N4 and a molecular weight of 363.18 g/mol. Its IUPAC name is N-[[1-[3-bromo-5-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[3-bromo-5-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66204894 |
| Molecular Formula | C13H14BrF3N4 |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | N-[[1-[3-bromo-5-(trifluoromethyl)phenyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2cc(Br)cc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C13H14BrF3N4/c1-2-3-18-7-11-8-21(20-19-11)12-5-9(13(15,16)17)4-10(14)6-12/h4-6,8,18H,2-3,7H2,1H3 |
| InChIKey | DLQRFFHOXLBVGO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|