C14H17F3N4 — CID 66192180
N-[[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 66192180) has the molecular formula C14H17F3N4 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-[[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66192180 |
| Molecular Formula | C14H17F3N4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(Cc2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C14H17F3N4/c1-2-7-18-8-12-10-21(20-19-12)9-11-5-3-4-6-13(11)14(15,16)17/h3-6,10,18H,2,7-9H2,1H3 |
| InChIKey | LGCICMGVVQIOLO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|