C22H18F3N5 — CID 67265099
3-[1-pyridin-3-yl-2-[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]ethyl]pyridine (PubChem CID 67265099) has the molecular formula C22H18F3N5 and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[1-pyridin-3-yl-2-[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]ethyl]pyridine.
| Compound Name | 3-[1-pyridin-3-yl-2-[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 67265099 |
| Molecular Formula | C22H18F3N5 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[1-pyridin-3-yl-2-[1-[[2-(trifluoromethyl)phenyl]methyl]triazol-4-yl]ethyl]pyridine |
| SMILES | FC(F)(F)c1ccccc1Cn1cc(CC(c2cccnc2)c2cccnc2)nn1 |
| InChI | InChI=1S/C22H18F3N5/c23-22(24,25)21-8-2-1-5-18(21)14-30-15-19(28-29-30)11-20(16-6-3-9-26-12-16)17-7-4-10-27-13-17/h1-10,12-13,15,20H,11,14H2 |
| InChIKey | HZHCBMSQMVUGNI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |