C11H11F3N4O — CID 122241298
[1-[[2-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]methanamine (PubChem CID 122241298) has the molecular formula C11H11F3N4O and a molecular weight of 272.23 g/mol. Its IUPAC name is [1-[[2-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]methanamine.
| Compound Name | [1-[[2-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 122241298 |
| Molecular Formula | C11H11F3N4O |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | [1-[[2-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]methanamine |
| SMILES | NCc1cn(Cc2ccccc2OC(F)(F)F)nn1 |
| InChI | InChI=1S/C11H11F3N4O/c12-11(13,14)19-10-4-2-1-3-8(10)6-18-7-9(5-15)16-17-18/h1-4,7H,5-6,15H2 |
| InChIKey | PRQFMFYPLIGJCL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |