C13H17F3N2O — CID 115311651
[1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-yl]methanamine (PubChem CID 115311651) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is [1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115311651 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-yl]methanamine |
| SMILES | NCC1CCCN1Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)19-12-6-2-1-4-10(12)9-18-7-3-5-11(18)8-17/h1-2,4,6,11H,3,5,7-9,17H2 |
| InChIKey | DMFBTDVWAQZOER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |