C13H17N5O2 — CID 66206706
N-[[1-(2-methyl-5-nitrophenyl)triazol-4-yl]methyl]propan-1-amine (PubChem CID 66206706) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[[1-(2-methyl-5-nitrophenyl)triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2-methyl-5-nitrophenyl)triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66206706 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[[1-(2-methyl-5-nitrophenyl)triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(-c2cc([N+](=O)[O-])ccc2C)nn1 |
| InChI | InChI=1S/C13H17N5O2/c1-3-6-14-8-11-9-17(16-15-11)13-7-12(18(19)20)5-4-10(13)2/h4-5,7,9,14H,3,6,8H2,1-2H3 |
| InChIKey | YUYSECQYKDSTHB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|