C26H29NO4 — CID 156877604
4-[5-hydroxy-2-(oxan-4-yl)-1-phenylindol-3-yl]cyclohexane-1-carboxylic acid (PubChem CID 156877604) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-[5-hydroxy-2-(oxan-4-yl)-1-phenylindol-3-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[5-hydroxy-2-(oxan-4-yl)-1-phenylindol-3-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 156877604 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[5-hydroxy-2-(oxan-4-yl)-1-phenylindol-3-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(c2c(C3CCOCC3)n(-c3ccccc3)c3ccc(O)cc23)CC1 |
| InChI | InChI=1S/C26H29NO4/c28-21-10-11-23-22(16-21)24(17-6-8-19(9-7-17)26(29)30)25(18-12-14-31-15-13-18)27(23)20-4-2-1-3-5-20/h1-5,10-11,16-19,28H,6-9,12-15H2,(H,29,30) |
| InChIKey | QBORIVQOEKGULJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |