C19H25NO3 — CID 156877735
[2-(hydroxyamino)-5-propan-2-ylphenyl] (2E,4E)-2-ethenyl-5-methylhepta-2,4-dienoate (PubChem CID 156877735) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [2-(hydroxyamino)-5-propan-2-ylphenyl] (2E,4E)-2-ethenyl-5-methylhepta-2,4-dienoate.
| Compound Name | [2-(hydroxyamino)-5-propan-2-ylphenyl] (2E,4E)-2-ethenyl-5-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 156877735 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [2-(hydroxyamino)-5-propan-2-ylphenyl] (2E,4E)-2-ethenyl-5-methylhepta-2,4-dienoate |
| SMILES | C=C/C(=C\C=C(/C)CC)C(=O)Oc1cc(C(C)C)ccc1NO |
| InChI | InChI=1S/C19H25NO3/c1-6-14(5)8-9-15(7-2)19(21)23-18-12-16(13(3)4)10-11-17(18)20-22/h7-13,20,22H,2,6H2,1,3-5H3/b14-8+,15-9+ |
| InChIKey | NUPDBVVGRROTSK-VOMDNODZSA-N |
| XLogP | 4.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|