C17H23NO4 — CID 156877827
[2-(hydroxyamino)-5-propan-2-ylphenyl] 2,3,5-trimethyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 156877827) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is [2-(hydroxyamino)-5-propan-2-ylphenyl] 2,3,5-trimethyl-2,3-dihydrofuran-4-carboxylate.
| Compound Name | [2-(hydroxyamino)-5-propan-2-ylphenyl] 2,3,5-trimethyl-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 156877827 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [2-(hydroxyamino)-5-propan-2-ylphenyl] 2,3,5-trimethyl-2,3-dihydrofuran-4-carboxylate |
| SMILES | CC1=C(C(=O)Oc2cc(C(C)C)ccc2NO)C(C)C(C)O1 |
| InChI | InChI=1S/C17H23NO4/c1-9(2)13-6-7-14(18-20)15(8-13)22-17(19)16-10(3)11(4)21-12(16)5/h6-11,18,20H,1-5H3 |
| InChIKey | CQPMPCLPVCNNAW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|