C35H44O4 — CID 142748007
bis[2,5-di(propan-2-yl)phenyl] 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142748007) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is bis[2,5-di(propan-2-yl)phenyl] 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis[2,5-di(propan-2-yl)phenyl] 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748007 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | bis[2,5-di(propan-2-yl)phenyl] 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CC(C)c1ccc(C(C)C)c(OC(=O)C2=C(C(=O)Oc3cc(C(C)C)ccc3C(C)C)C3C=CC2C3(C)C)c1 |
| InChI | InChI=1S/C35H44O4/c1-19(2)23-11-13-25(21(5)6)29(17-23)38-33(36)31-27-15-16-28(35(27,9)10)32(31)34(37)39-30-18-24(20(3)4)12-14-26(30)22(7)8/h11-22,27-28H,1-10H3 |
| InChIKey | CZTIZGXBJAUFMA-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|