C38H62N2O4+2 — CID 153280952
10-[dimethyl-[2-(2-methyl-5-propan-2-ylphenoxy)-2-oxoethyl]azaniumyl]decyl-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium (PubChem CID 153280952) has the molecular formula C38H62N2O4+2 and a molecular weight of 610.92 g/mol. Its IUPAC name is 10-[dimethyl-[2-(2-methyl-5-propan-2-ylphenoxy)-2-oxoethyl]azaniumyl]decyl-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium.
| Compound Name | 10-[dimethyl-[2-(2-methyl-5-propan-2-ylphenoxy)-2-oxoethyl]azaniumyl]decyl-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 153280952 |
| Molecular Formula | C38H62N2O4+2 |
| Molecular Weight | 610.92 g/mol |
| Exact Mass | 610.47 |
| IUPAC Name | 10-[dimethyl-[2-(2-methyl-5-propan-2-ylphenoxy)-2-oxoethyl]azaniumyl]decyl-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C[N+](C)(C)CCCCCCCCCC[N+](C)(C)CC(=O)Oc2cc(C(C)C)ccc2C)c1 |
| InChI | InChI=1S/C38H62N2O4/c1-29(2)33-21-20-32(6)35(26-33)43-37(41)27-39(7,8)23-17-15-13-11-12-14-16-18-24-40(9,10)28-38(42)44-36-25-31(5)19-22-34(36)30(3)4/h19-22,25-26,29-30H,11-18,23-24,27-28H2,1-10H3/q+2 |
| InChIKey | ODFKNJVXDRGDKD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.92 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|