C20H35N2O2+ — CID 58592307
2-(dimethylamino)ethyl-dimethyl-[4-(5-methyl-2-propan-2-ylphenoxy)-4-oxobutyl]azanium (PubChem CID 58592307) has the molecular formula C20H35N2O2+ and a molecular weight of 335.51 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-dimethyl-[4-(5-methyl-2-propan-2-ylphenoxy)-4-oxobutyl]azanium.
| Compound Name | 2-(dimethylamino)ethyl-dimethyl-[4-(5-methyl-2-propan-2-ylphenoxy)-4-oxobutyl]azanium |
|---|---|
| PubChem CID | 58592307 |
| Molecular Formula | C20H35N2O2+ |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | 2-(dimethylamino)ethyl-dimethyl-[4-(5-methyl-2-propan-2-ylphenoxy)-4-oxobutyl]azanium |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)CCC[N+](C)(C)CCN(C)C)c1 |
| InChI | InChI=1S/C20H35N2O2/c1-16(2)18-11-10-17(3)15-19(18)24-20(23)9-8-13-22(6,7)14-12-21(4)5/h10-11,15-16H,8-9,12-14H2,1-7H3/q+1 |
| InChIKey | JCAUMRDJZDQZIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|