C38H61N2O4+ — CID 159647899
[10-(dimethylamino)-12-(2-methyl-5-propan-2-ylphenoxy)-12-oxododecyl]-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium (PubChem CID 159647899) has the molecular formula C38H61N2O4+ and a molecular weight of 609.92 g/mol. Its IUPAC name is [10-(dimethylamino)-12-(2-methyl-5-propan-2-ylphenoxy)-12-oxododecyl]-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium.
| Compound Name | [10-(dimethylamino)-12-(2-methyl-5-propan-2-ylphenoxy)-12-oxododecyl]-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 159647899 |
| Molecular Formula | C38H61N2O4+ |
| Molecular Weight | 609.92 g/mol |
| Exact Mass | 609.46 |
| IUPAC Name | [10-(dimethylamino)-12-(2-methyl-5-propan-2-ylphenoxy)-12-oxododecyl]-dimethyl-[2-(5-methyl-2-propan-2-ylphenoxy)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C[N+](C)(C)CCCCCCCCCC(CC(=O)Oc2cc(C(C)C)ccc2C)N(C)C)c1 |
| InChI | InChI=1S/C38H61N2O4/c1-28(2)32-21-20-31(6)35(25-32)43-37(41)26-33(39(7)8)18-16-14-12-11-13-15-17-23-40(9,10)27-38(42)44-36-24-30(5)19-22-34(36)29(3)4/h19-22,24-25,28-29,33H,11-18,23,26-27H2,1-10H3/q+1 |
| InChIKey | MREMVZJERSZMJM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.92 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|