C19H31ClN2O3 — CID 155566953
(2-methyl-5-propan-2-ylphenyl) 5-[2-(dimethylamino)ethylamino]-5-oxopentanoate;hydrochloride (PubChem CID 155566953) has the molecular formula C19H31ClN2O3 and a molecular weight of 370.92 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) 5-[2-(dimethylamino)ethylamino]-5-oxopentanoate;hydrochloride.
| Compound Name | (2-methyl-5-propan-2-ylphenyl) 5-[2-(dimethylamino)ethylamino]-5-oxopentanoate;hydrochloride |
|---|---|
| PubChem CID | 155566953 |
| Molecular Formula | C19H31ClN2O3 |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) 5-[2-(dimethylamino)ethylamino]-5-oxopentanoate;hydrochloride |
| SMILES | Cc1ccc(C(C)C)cc1OC(=O)CCCC(=O)NCCN(C)C.Cl |
| InChI | InChI=1S/C19H30N2O3.ClH/c1-14(2)16-10-9-15(3)17(13-16)24-19(23)8-6-7-18(22)20-11-12-21(4)5;/h9-10,13-14H,6-8,11-12H2,1-5H3,(H,20,22);1H |
| InChIKey | BCIDATNQNVBLAC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|