C26H28O2 — CID 141338319
(2-methyl-5-propan-2-ylphenyl) (3R)-3,4-diphenylbutanoate (PubChem CID 141338319) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2-methyl-5-propan-2-ylphenyl) (3R)-3,4-diphenylbutanoate.
| Compound Name | (2-methyl-5-propan-2-ylphenyl) (3R)-3,4-diphenylbutanoate |
|---|---|
| PubChem CID | 141338319 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (2-methyl-5-propan-2-ylphenyl) (3R)-3,4-diphenylbutanoate |
| SMILES | Cc1ccc(C(C)C)cc1OC(=O)C[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28O2/c1-19(2)23-15-14-20(3)25(17-23)28-26(27)18-24(22-12-8-5-9-13-22)16-21-10-6-4-7-11-21/h4-15,17,19,24H,16,18H2,1-3H3/t24-/m1/s1 |
| InChIKey | VREAHUYJALTOKV-XMMPIXPASA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|