C16H27NO2S — CID 156878014
1-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperidin-4-ol (PubChem CID 156878014) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 1-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperidin-4-ol.
| Compound Name | 1-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperidin-4-ol |
|---|---|
| PubChem CID | 156878014 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-[(2E,4Z,6Z)-6-propan-2-ylocta-2,4,6-trien-3-yl]sulfinylpiperidin-4-ol |
| SMILES | C/C=C(\C=C/C(=C\C)S(=O)N1CCC(O)CC1)C(C)C |
| InChI | InChI=1S/C16H27NO2S/c1-5-14(13(3)4)7-8-16(6-2)20(19)17-11-9-15(18)10-12-17/h5-8,13,15,18H,9-12H2,1-4H3/b8-7-,14-5+,16-6+ |
| InChIKey | SOZJYBXFNONEPY-WAMZBXSRSA-N |
| XLogP | 3.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|