C19H25NOS — CID 156877944
1-[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]sulfinyl-3,4-dihydro-2H-quinoline (PubChem CID 156877944) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 1-[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]sulfinyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]sulfinyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 156877944 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(3Z,5Z)-5-propan-2-ylhepta-1,3,5-trien-2-yl]sulfinyl-3,4-dihydro-2H-quinoline |
| SMILES | C=C(/C=C\C(=C/C)C(C)C)S(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H25NOS/c1-5-17(15(2)3)13-12-16(4)22(21)20-14-8-10-18-9-6-7-11-19(18)20/h5-7,9,11-13,15H,4,8,10,14H2,1-3H3/b13-12-,17-5+ |
| InChIKey | HIZZKWNUPSMVAR-OAVBNREASA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|