C20H17ClFN3 — CID 156879470
7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline (PubChem CID 156879470) has the molecular formula C20H17ClFN3 and a molecular weight of 353.83 g/mol. Its IUPAC name is 7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline.
| Compound Name | 7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
|---|---|
| PubChem CID | 156879470 |
| Molecular Formula | C20H17ClFN3 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
| SMILES | Cc1c2nc(Cl)c(C(C)C)c(-c3ccc(F)cc3)c2cc2cn[nH]c12 |
| InChI | InChI=1S/C20H17ClFN3/c1-10(2)16-17(12-4-6-14(22)7-5-12)15-8-13-9-23-25-18(13)11(3)19(15)24-20(16)21/h4-10H,1-3H3,(H,23,25) |
| InChIKey | BNKHAFSAZZNGSW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|