C26H27FN3O2+ — CID 156879549
5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)-2H-pyrazolo[4,3-g]isoquinolin-1-ium (PubChem CID 156879549) has the molecular formula C26H27FN3O2+ and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)-2H-pyrazolo[4,3-g]isoquinolin-1-ium.
| Compound Name | 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
|---|---|
| PubChem CID | 156879549 |
| Molecular Formula | C26H27FN3O2+ |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)ncc3cc4c(c[nH][n+]4C4CCCCO4)cc23)cc1 |
| InChI | InChI=1S/C26H26FN3O2/c27-21-6-4-17(5-7-21)25-22-13-20-16-29-30(24-3-1-2-10-32-24)23(20)14-19(22)15-28-26(25)18-8-11-31-12-9-18/h4-7,13-16,18,24H,1-3,8-12H2/p+1 |
| InChIKey | AJRLBJBOLVOVOS-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 51.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|