C19H15ClFN3 — CID 156879702
7-chloro-5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline (PubChem CID 156879702) has the molecular formula C19H15ClFN3 and a molecular weight of 339.80 g/mol. Its IUPAC name is 7-chloro-5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline.
| Compound Name | 7-chloro-5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
|---|---|
| PubChem CID | 156879702 |
| Molecular Formula | C19H15ClFN3 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 7-chloro-5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrazolo[4,3-g]quinoline |
| SMILES | CC(C)c1c(Cl)nc2cc3[nH]ncc3cc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15ClFN3/c1-10(2)17-18(11-3-5-13(21)6-4-11)14-7-12-9-22-24-15(12)8-16(14)23-19(17)20/h3-10H,1-2H3,(H,22,24) |
| InChIKey | BDUDNTIEYBIVHC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|