About 1-tert-butyl-3-chlorobenzene;methyl formate
1-tert-butyl-3-chlorobenzene;methyl formate (PubChem CID 156883526) has the molecular formula C12H17ClO2
and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-tert-butyl-3-chlorobenzene;methyl formate.
Molecular Properties
| Compound Name | 1-tert-butyl-3-chlorobenzene;methyl formate |
| PubChem CID | 156883526 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-tert-butyl-3-chlorobenzene;methyl formate |
| SMILES | CC(C)(C)c1cccc(Cl)c1.COC=O |
| InChI | InChI=1S/C10H13Cl.C2H4O2/c1-10(2,3)8-5-4-6-9(11)7-8;1-4-2-3/h4-7H,1-3H3;2H,1H3 |
| InChIKey | OCEBONONJRPYMC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-chlorobenzene;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-chlorobenzene;methyl formate?
The IUPAC name of 1-tert-butyl-3-chlorobenzene;methyl formate (CID 156883526) is 1-tert-butyl-3-chlorobenzene;methyl formate.
What is the SMILES notation for 1-tert-butyl-3-chlorobenzene;methyl formate?
The canonical SMILES for 1-tert-butyl-3-chlorobenzene;methyl formate is CC(C)(C)c1cccc(Cl)c1.COC=O.
What is the InChIKey of 1-tert-butyl-3-chlorobenzene;methyl formate?
The InChIKey is OCEBONONJRPYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.C2H4O2/c1-10(2,3)8-5-4-6-9(11)7-8;1-4-2-3/h4-7H,1-3H3;2H,1H3.
What are the key properties of 1-tert-butyl-3-chlorobenzene;methyl formate?
1-tert-butyl-3-chlorobenzene;methyl formate has a molecular weight of 228.72 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-chlorobenzene;methyl formate is sourced from PubChem (CID 156883526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).