About ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen
ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen (PubChem CID 156886026) has the molecular formula C18H34O
and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen |
| PubChem CID | 156886026 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen |
| SMILES | CC.CC.CCCc1ccc(C(=O)C(C)CC)cc1.[H][H] |
| InChI | InChI=1S/C14H20O.2C2H6.H2/c1-4-6-12-7-9-13(10-8-12)14(15)11(3)5-2;2*1-2;/h7-11H,4-6H2,1-3H3;2*1-2H3;1H |
| InChIKey | ANVVTOCVTYWVRN-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen?
The IUPAC name of ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen (CID 156886026) is ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen.
What is the SMILES notation for ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen?
The canonical SMILES for ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen is CC.CC.CCCc1ccc(C(=O)C(C)CC)cc1.[H][H].
What is the InChIKey of ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen?
The InChIKey is ANVVTOCVTYWVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O.2C2H6.H2/c1-4-6-12-7-9-13(10-8-12)14(15)11(3)5-2;2*1-2;/h7-11H,4-6H2,1-3H3;2*1-2H3;1H.
What are the key properties of ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen?
ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen has a molecular weight of 266.47 g/mol, XLogP of 6.17, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1-(4-propylphenyl)butan-1-one;molecular hydrogen is sourced from PubChem (CID 156886026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).