C9H10BrNO3S — CID 156888760
ethyl 4-(5-bromo-1,3-thiazol-2-yl)-3-oxobutanoate (PubChem CID 156888760) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is ethyl 4-(5-bromo-1,3-thiazol-2-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(5-bromo-1,3-thiazol-2-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 156888760 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | ethyl 4-(5-bromo-1,3-thiazol-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cc1ncc(Br)s1 |
| InChI | InChI=1S/C9H10BrNO3S/c1-2-14-9(13)4-6(12)3-8-11-5-7(10)15-8/h5H,2-4H2,1H3 |
| InChIKey | VNJNTRXGADYERX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|