C8H8BrNO3S — CID 83826150
ethyl 3-(5-bromo-1,3-thiazol-2-yl)-2-oxopropanoate (PubChem CID 83826150) has the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. Its IUPAC name is ethyl 3-(5-bromo-1,3-thiazol-2-yl)-2-oxopropanoate.
| Compound Name | ethyl 3-(5-bromo-1,3-thiazol-2-yl)-2-oxopropanoate |
|---|---|
| PubChem CID | 83826150 |
| Molecular Formula | C8H8BrNO3S |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | ethyl 3-(5-bromo-1,3-thiazol-2-yl)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1ncc(Br)s1 |
| InChI | InChI=1S/C8H8BrNO3S/c1-2-13-8(12)5(11)3-7-10-4-6(9)14-7/h4H,2-3H2,1H3 |
| InChIKey | HUFQYNZKXMJHJP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|