C12H17BrN2O3S — CID 116537791
ethyl 2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537791) has the molecular formula C12H17BrN2O3S and a molecular weight of 349.25 g/mol. Its IUPAC name is ethyl 2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537791 |
| Molecular Formula | C12H17BrN2O3S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | ethyl 2-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1ncc(Br)s1)C(C)(C)C |
| InChI | InChI=1S/C12H17BrN2O3S/c1-5-18-10(17)8(12(2,3)4)9(16)15-11-14-6-7(13)19-11/h6,8H,5H2,1-4H3,(H,14,15,16) |
| InChIKey | SRRNXWMHXUJZTP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|