C7H10BrN3OS — CID 130563823
(2S)-N-(5-bromo-1,3-thiazol-2-yl)-2-(methylamino)propanamide (PubChem CID 130563823) has the molecular formula C7H10BrN3OS and a molecular weight of 264.15 g/mol. Its IUPAC name is (2S)-N-(5-bromo-1,3-thiazol-2-yl)-2-(methylamino)propanamide.
| Compound Name | (2S)-N-(5-bromo-1,3-thiazol-2-yl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 130563823 |
| Molecular Formula | C7H10BrN3OS |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | (2S)-N-(5-bromo-1,3-thiazol-2-yl)-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C7H10BrN3OS/c1-4(9-2)6(12)11-7-10-3-5(8)13-7/h3-4,9H,1-2H3,(H,10,11,12)/t4-/m0/s1 |
| InChIKey | ACEWIVUIOXRQGG-BYPYZUCNSA-N |
| XLogP | 1.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |