C6H5BrN2O3S — CID 53352081
methyl 2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoacetate (PubChem CID 53352081) has the molecular formula C6H5BrN2O3S and a molecular weight of 265.09 g/mol. Its IUPAC name is methyl 2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 53352081 |
| Molecular Formula | C6H5BrN2O3S |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | methyl 2-[(5-bromo-1,3-thiazol-2-yl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C6H5BrN2O3S/c1-12-5(11)4(10)9-6-8-2-3(7)13-6/h2H,1H3,(H,8,9,10) |
| InChIKey | YOWHFUKXRPXFAQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|