C16H29NO4 — CID 156890326
ethyl (4R)-4-acetamidocyclohexene-1-carboxylate;pentan-3-ol (PubChem CID 156890326) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl (4R)-4-acetamidocyclohexene-1-carboxylate;pentan-3-ol.
| Compound Name | ethyl (4R)-4-acetamidocyclohexene-1-carboxylate;pentan-3-ol |
|---|---|
| PubChem CID | 156890326 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | ethyl (4R)-4-acetamidocyclohexene-1-carboxylate;pentan-3-ol |
| SMILES | CCC(O)CC.CCOC(=O)C1=CC[C@H](NC(C)=O)CC1 |
| InChI | InChI=1S/C11H17NO3.C5H12O/c1-3-15-11(14)9-4-6-10(7-5-9)12-8(2)13;1-3-5(6)4-2/h4,10H,3,5-7H2,1-2H3,(H,12,13);5-6H,3-4H2,1-2H3/t10-;/m0./s1 |
| InChIKey | PXLFUIOLBHUMOS-PPHPATTJSA-N |
| XLogP | 2.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |