C15H27NO2S — CID 156890356
N-(8-hydroxysulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)pentanamide (PubChem CID 156890356) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is N-(8-hydroxysulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)pentanamide.
| Compound Name | N-(8-hydroxysulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)pentanamide |
|---|---|
| PubChem CID | 156890356 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-(8-hydroxysulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)pentanamide |
| SMILES | CCCCC(=O)NC1CCCC2CCCC(SO)C21 |
| InChI | InChI=1S/C15H27NO2S/c1-2-3-10-14(17)16-12-8-4-6-11-7-5-9-13(19-18)15(11)12/h11-13,15,18H,2-10H2,1H3,(H,16,17) |
| InChIKey | PTLIRQRMVKGRND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|