C68H57BN2 — CID 156895251
5,17-ditert-butyl-4,11,18-triphenyl-8,14-bis(3-phenylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 156895251) has the molecular formula C68H57BN2 and a molecular weight of 913.03 g/mol. Its IUPAC name is 5,17-ditert-butyl-4,11,18-triphenyl-8,14-bis(3-phenylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 5,17-ditert-butyl-4,11,18-triphenyl-8,14-bis(3-phenylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 156895251 |
| Molecular Formula | C68H57BN2 |
| Molecular Weight | 913.03 g/mol |
| Exact Mass | 912.46 |
| IUPAC Name | 5,17-ditert-butyl-4,11,18-triphenyl-8,14-bis(3-phenylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC(C)(C)c1cc2c(cc1-c1ccccc1)B1c3cc(-c4ccccc4)c(C(C)(C)C)cc3N(c3cccc(-c4ccccc4)c3)c3cc(-c4ccccc4)cc(c31)N2c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C68H57BN2/c1-67(2,3)58-44-62-60(42-56(58)49-30-18-10-19-31-49)69-61-43-57(50-32-20-11-21-33-50)59(68(4,5)6)45-63(61)71(55-37-23-35-52(39-55)47-26-14-8-15-27-47)65-41-53(48-28-16-9-17-29-48)40-64(66(65)69)70(62)54-36-22-34-51(38-54)46-24-12-7-13-25-46/h7-45H,1-6H3 |
| InChIKey | QQUHPKDNSKOSCQ-UHFFFAOYSA-N |
| XLogP | 16.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.03 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|