C74H61BN2 — CID 168759891
5,17-ditert-butyl-8,14-bis(3,5-diphenylphenyl)-4,18-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene (PubChem CID 168759891) has the molecular formula C74H61BN2 and a molecular weight of 989.13 g/mol. Its IUPAC name is 5,17-ditert-butyl-8,14-bis(3,5-diphenylphenyl)-4,18-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene.
| Compound Name | 5,17-ditert-butyl-8,14-bis(3,5-diphenylphenyl)-4,18-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 168759891 |
| Molecular Formula | C74H61BN2 |
| Molecular Weight | 989.13 g/mol |
| Exact Mass | 988.49 |
| IUPAC Name | 5,17-ditert-butyl-8,14-bis(3,5-diphenylphenyl)-4,18-diphenyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene |
| SMILES | CC(C)(C)c1cc2c(cc1-c1ccccc1)B1c3cc(-c4ccccc4)c(C(C)(C)C)cc3N(c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3cccc(c31)N2c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C74H61BN2/c1-73(2,3)64-48-70-66(46-62(64)54-34-21-11-22-35-54)75-67-47-63(55-36-23-12-24-37-55)65(74(4,5)6)49-71(67)77(61-44-58(52-30-17-9-18-31-52)41-59(45-61)53-32-19-10-20-33-53)69-39-25-38-68(72(69)75)76(70)60-42-56(50-26-13-7-14-27-50)40-57(43-60)51-28-15-8-16-29-51/h7-49H,1-6H3 |
| InChIKey | JLUJENSAVOLEES-UHFFFAOYSA-N |
| XLogP | 18.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.13 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|