C20H19BrN2O5 — CID 156895606
tert-butyl N-[(4bR,9bR)-1-amino-7-bromo-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]carbamate (PubChem CID 156895606) has the molecular formula C20H19BrN2O5 and a molecular weight of 447.29 g/mol. Its IUPAC name is tert-butyl N-[(4bR,9bR)-1-amino-7-bromo-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]carbamate.
| Compound Name | tert-butyl N-[(4bR,9bR)-1-amino-7-bromo-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]carbamate |
|---|---|
| PubChem CID | 156895606 |
| Molecular Formula | C20H19BrN2O5 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | tert-butyl N-[(4bR,9bR)-1-amino-7-bromo-4b-hydroxy-10-oxoindeno[1,2-b][1]benzofuran-9b-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@]12C(=O)c3c(N)cccc3[C@@]1(O)Oc1cc(Br)ccc12 |
| InChI | InChI=1S/C20H19BrN2O5/c1-18(2,3)28-17(25)23-19-11-8-7-10(21)9-14(11)27-20(19,26)12-5-4-6-13(22)15(12)16(19)24/h4-9,26H,22H2,1-3H3,(H,23,25)/t19-,20-/m1/s1 |
| InChIKey | WLAWQLGRDSQSCD-WOJBJXKFSA-N |
| XLogP | 3.19 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|