C20H30N2O3 — CID 10641332
tert-butyl N-[1-(2-aminobenzoyl)-4,4-dimethylcyclohexyl]carbamate (PubChem CID 10641332) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl N-[1-(2-aminobenzoyl)-4,4-dimethylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-aminobenzoyl)-4,4-dimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 10641332 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl N-[1-(2-aminobenzoyl)-4,4-dimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CCC(NC(=O)OC(C)(C)C)(C(=O)c2ccccc2N)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-18(2,3)25-17(24)22-20(12-10-19(4,5)11-13-20)16(23)14-8-6-7-9-15(14)21/h6-9H,10-13,21H2,1-5H3,(H,22,24) |
| InChIKey | YUDLNBSSYIIAIE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|