C19H27N3O3 — CID 68555328
tert-butyl N-[5-[(2-aminophenyl)carbamoyl]-1-bicyclo[3.1.1]heptanyl]carbamate (PubChem CID 68555328) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-aminophenyl)carbamoyl]-1-bicyclo[3.1.1]heptanyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-aminophenyl)carbamoyl]-1-bicyclo[3.1.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 68555328 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl N-[5-[(2-aminophenyl)carbamoyl]-1-bicyclo[3.1.1]heptanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CCCC(C(=O)Nc3ccccc3N)(C1)C2 |
| InChI | InChI=1S/C19H27N3O3/c1-17(2,3)25-16(24)22-19-10-6-9-18(11-19,12-19)15(23)21-14-8-5-4-7-13(14)20/h4-5,7-8H,6,9-12,20H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | JSKBLDKNSYPVKL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|