C19H28N2O3 — CID 10640342
tert-butyl 2-(2-aminobenzoyl)-4,4-dimethylpiperidine-1-carboxylate (PubChem CID 10640342) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 2-(2-aminobenzoyl)-4,4-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-aminobenzoyl)-4,4-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10640342 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 2-(2-aminobenzoyl)-4,4-dimethylpiperidine-1-carboxylate |
| SMILES | CC1(C)CCN(C(=O)OC(C)(C)C)C(C(=O)c2ccccc2N)C1 |
| InChI | InChI=1S/C19H28N2O3/c1-18(2,3)24-17(23)21-11-10-19(4,5)12-15(21)16(22)13-8-6-7-9-14(13)20/h6-9,15H,10-12,20H2,1-5H3 |
| InChIKey | PLUVCDQSZWOHMX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|