C18H18F3N5 — CID 156898005
2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 156898005) has the molecular formula C18H18F3N5 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 156898005 |
| Molecular Formula | C18H18F3N5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccc2nc(CN3CCN(c4ccncc4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H18F3N5/c19-18(20,21)13-1-2-15-16(11-13)24-17(23-15)12-25-7-9-26(10-8-25)14-3-5-22-6-4-14/h1-6,11H,7-10,12H2,(H,23,24) |
| InChIKey | SWCVMAXRJONCCM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |