C19H20N4O2 — CID 156898016
2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-1H-indole-5-carboxylic acid (PubChem CID 156898016) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-1H-indole-5-carboxylic acid.
| Compound Name | 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 156898016 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[(4-pyridin-4-ylpiperazin-1-yl)methyl]-1H-indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c(CN3CCN(c4ccncc4)CC3)cc2c1 |
| InChI | InChI=1S/C19H20N4O2/c24-19(25)14-1-2-18-15(11-14)12-16(21-18)13-22-7-9-23(10-8-22)17-3-5-20-6-4-17/h1-6,11-12,21H,7-10,13H2,(H,24,25) |
| InChIKey | YLEYCGJZQLKLEL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |