C17H17ClN3O2- — CID 156641365
3-chloro-4-[(4-pyridin-4-ylpiperazin-1-yl)methyl]benzoate (PubChem CID 156641365) has the molecular formula C17H17ClN3O2- and a molecular weight of 330.80 g/mol. Its IUPAC name is 3-chloro-4-[(4-pyridin-4-ylpiperazin-1-yl)methyl]benzoate.
| Compound Name | 3-chloro-4-[(4-pyridin-4-ylpiperazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 156641365 |
| Molecular Formula | C17H17ClN3O2- |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-chloro-4-[(4-pyridin-4-ylpiperazin-1-yl)methyl]benzoate |
| SMILES | O=C([O-])c1ccc(CN2CCN(c3ccncc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-16-11-13(17(22)23)1-2-14(16)12-20-7-9-21(10-8-20)15-3-5-19-6-4-15/h1-6,11H,7-10,12H2,(H,22,23)/p-1 |
| InChIKey | LWAUPECBRQYPKR-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |