C29H28ClN7O2 — CID 156898567
2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-N-(4-piperazin-1-ylphenyl)-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 156898567) has the molecular formula C29H28ClN7O2 and a molecular weight of 542.04 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-N-(4-piperazin-1-ylphenyl)-1,4-dihydropyrimidine-5-carboxamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-N-(4-piperazin-1-ylphenyl)-1,4-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156898567 |
| Molecular Formula | C29H28ClN7O2 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-N-(4-piperazin-1-ylphenyl)-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(N3CCNCC3)cc2)C(c2ccccc2Cl)N=C(Nc2nc3ccccc3o2)N1 |
| InChI | InChI=1S/C29H28ClN7O2/c1-18-25(27(38)33-19-10-12-20(13-11-19)37-16-14-31-15-17-37)26(21-6-2-3-7-22(21)30)35-28(32-18)36-29-34-23-8-4-5-9-24(23)39-29/h2-13,26,31H,14-17H2,1H3,(H,33,38)(H2,32,34,35,36) |
| InChIKey | WBVZFLNMFBRBFJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|