C31H46BN5O — CID 156899098
CID 156899098 (PubChem CID 156899098) has the molecular formula C31H46BN5O and a molecular weight of 515.56 g/mol.
| Compound Name | CID 156899098 |
|---|---|
| PubChem CID | 156899098 |
| Molecular Formula | C31H46BN5O |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | — |
| SMILES | CCCc1cc(NC2CCCC2)n2nccc2n1.[B]CC(C)(CC)c1ccc(C(C)(CC)C(=O)NC)cc1 |
| InChI | InChI=1S/C17H26BNO.C14H20N4/c1-6-16(3,12-18)13-8-10-14(11-9-13)17(4,7-2)15(20)19-5;1-2-5-12-10-14(16-11-6-3-4-7-11)18-13(17-12)8-9-15-18/h8-11H,6-7,12H2,1-5H3,(H,19,20);8-11,16H,2-7H2,1H3 |
| InChIKey | ZLKYLFNIAWUQQG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|