C32H46BN5O — CID 174062809
CID 174062809 (PubChem CID 174062809) has the molecular formula C32H46BN5O and a molecular weight of 527.57 g/mol.
| Compound Name | CID 174062809 |
|---|---|
| PubChem CID | 174062809 |
| Molecular Formula | C32H46BN5O |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.38 |
| IUPAC Name | — |
| SMILES | [B]CC(C)(CC)c1ccc(C(C)(CC)C(=O)N[C@H]2CC[C@H](Nc3cc(C(CC)CC)nc4ccnn34)C2)cc1 |
| InChI | InChI=1S/C32H46BN5O/c1-7-22(8-2)27-20-29(38-28(37-27)17-18-34-38)35-25-15-16-26(19-25)36-30(39)32(6,10-4)24-13-11-23(12-14-24)31(5,9-3)21-33/h11-14,17-18,20,22,25-26,35H,7-10,15-16,19,21H2,1-6H3,(H,36,39)/t25-,26-,31?,32?/m0/s1 |
| InChIKey | PIKOTXLRRNLMAH-HLNXFCLESA-N |
| XLogP | 6.70 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|