C22H13ClN4 — CID 156900627
2-(4-chloro-6-naphthalen-2-yl-1,3,5-triazin-2-yl)quinoline (PubChem CID 156900627) has the molecular formula C22H13ClN4 and a molecular weight of 368.83 g/mol. Its IUPAC name is 2-(4-chloro-6-naphthalen-2-yl-1,3,5-triazin-2-yl)quinoline.
| Compound Name | 2-(4-chloro-6-naphthalen-2-yl-1,3,5-triazin-2-yl)quinoline |
|---|---|
| PubChem CID | 156900627 |
| Molecular Formula | C22H13ClN4 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-(4-chloro-6-naphthalen-2-yl-1,3,5-triazin-2-yl)quinoline |
| SMILES | Clc1nc(-c2ccc3ccccc3c2)nc(-c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C22H13ClN4/c23-22-26-20(17-10-9-14-5-1-2-7-16(14)13-17)25-21(27-22)19-12-11-15-6-3-4-8-18(15)24-19/h1-13H |
| InChIKey | QAGSIUVTLUAFOA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |