C22H36BN5O3 — CID 156900652
6-[(6-methoxy-3-pyridinyl)methyl]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperazin-2-yl]-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 156900652) has the molecular formula C22H36BN5O3 and a molecular weight of 429.37 g/mol. Its IUPAC name is 6-[(6-methoxy-3-pyridinyl)methyl]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperazin-2-yl]-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 6-[(6-methoxy-3-pyridinyl)methyl]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperazin-2-yl]-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 156900652 |
| Molecular Formula | C22H36BN5O3 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 6-[(6-methoxy-3-pyridinyl)methyl]-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperazin-2-yl]-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | COc1ccc(CN2C3CC2CN(C2CNC(B4OC(C)(C)C(C)(C)O4)CN2)C3)cn1 |
| InChI | InChI=1S/C22H36BN5O3/c1-21(2)22(3,4)31-23(30-21)18-10-25-19(11-24-18)27-13-16-8-17(14-27)28(16)12-15-6-7-20(29-5)26-9-15/h6-7,9,16-19,24-25H,8,10-14H2,1-5H3 |
| InChIKey | PDXOGZYDUALUCD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|