C19H20N8O2 — CID 156901282
9-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]-6-pyrazol-1-ylpurin-2-amine (PubChem CID 156901282) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 9-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]-6-pyrazol-1-ylpurin-2-amine.
| Compound Name | 9-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]-6-pyrazol-1-ylpurin-2-amine |
|---|---|
| PubChem CID | 156901282 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 9-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]-6-pyrazol-1-ylpurin-2-amine |
| SMILES | Nc1nc(-n2cccn2)c2ncn(Cc3cccc(CO[C@@H]4CCOC4)n3)c2n1 |
| InChI | InChI=1S/C19H20N8O2/c20-19-24-17-16(18(25-19)27-7-2-6-22-27)21-12-26(17)9-13-3-1-4-14(23-13)10-29-15-5-8-28-11-15/h1-4,6-7,12,15H,5,8-11H2,(H2,20,24,25)/t15-/m1/s1 |
| InChIKey | GTPZGEPGEXLCAF-OAHLLOKOSA-N |
| XLogP | 1.34 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |